C32H37ClN2O3 — CID 100593113
N-[(2-chlorophenyl)methyl]-N-[(2R)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-4-phenoxybutanamide (PubChem CID 100593113) has the molecular formula C32H37ClN2O3 and a molecular weight of 533.11 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N-[(2R)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-4-phenoxybutanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-N-[(2R)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-4-phenoxybutanamide |
|---|---|
| PubChem CID | 100593113 |
| Molecular Formula | C32H37ClN2O3 |
| Molecular Weight | 533.11 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N-[(2R)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-4-phenoxybutanamide |
| SMILES | O=C(NC1CCCCC1)[C@@H](Cc1ccccc1)N(Cc1ccccc1Cl)C(=O)CCCOc1ccccc1 |
| InChI | InChI=1S/C32H37ClN2O3/c33-29-20-11-10-15-26(29)24-35(31(36)21-12-22-38-28-18-8-3-9-19-28)30(23-25-13-4-1-5-14-25)32(37)34-27-16-6-2-7-17-27/h1,3-5,8-11,13-15,18-20,27,30H,2,6-7,12,16-17,21-24H2,(H,34,37)/t30-/m1/s1 |
| InChIKey | PIQAFTVPVJEWFJ-SSEXGKCCSA-N |
| XLogP | 6.59 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.11 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|