C32H36Cl2N2O3 — CID 100661458
N-[(2S)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,6-dichlorophenyl)methyl]-4-phenoxybutanamide (PubChem CID 100661458) has the molecular formula C32H36Cl2N2O3 and a molecular weight of 567.56 g/mol. Its IUPAC name is N-[(2S)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,6-dichlorophenyl)methyl]-4-phenoxybutanamide.
| Compound Name | N-[(2S)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,6-dichlorophenyl)methyl]-4-phenoxybutanamide |
|---|---|
| PubChem CID | 100661458 |
| Molecular Formula | C32H36Cl2N2O3 |
| Molecular Weight | 567.56 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | N-[(2S)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,6-dichlorophenyl)methyl]-4-phenoxybutanamide |
| SMILES | O=C(NC1CCCCC1)[C@H](Cc1ccccc1)N(Cc1c(Cl)cccc1Cl)C(=O)CCCOc1ccccc1 |
| InChI | InChI=1S/C32H36Cl2N2O3/c33-28-18-10-19-29(34)27(28)23-36(31(37)20-11-21-39-26-16-8-3-9-17-26)30(22-24-12-4-1-5-13-24)32(38)35-25-14-6-2-7-15-25/h1,3-5,8-10,12-13,16-19,25,30H,2,6-7,11,14-15,20-23H2,(H,35,38)/t30-/m0/s1 |
| InChIKey | WIWOZYALCCMCFT-PMERELPUSA-N |
| XLogP | 7.24 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.56 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|