C32H36Cl2N2O2S — CID 100662458
(2R)-2-[3-benzylsulfanylpropanoyl-[(2,6-dichlorophenyl)methyl]amino]-N-cyclohexyl-3-phenylpropanamide (PubChem CID 100662458) has the molecular formula C32H36Cl2N2O2S and a molecular weight of 583.63 g/mol. Its IUPAC name is (2R)-2-[3-benzylsulfanylpropanoyl-[(2,6-dichlorophenyl)methyl]amino]-N-cyclohexyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[3-benzylsulfanylpropanoyl-[(2,6-dichlorophenyl)methyl]amino]-N-cyclohexyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100662458 |
| Molecular Formula | C32H36Cl2N2O2S |
| Molecular Weight | 583.63 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | (2R)-2-[3-benzylsulfanylpropanoyl-[(2,6-dichlorophenyl)methyl]amino]-N-cyclohexyl-3-phenylpropanamide |
| SMILES | O=C(NC1CCCCC1)[C@@H](Cc1ccccc1)N(Cc1c(Cl)cccc1Cl)C(=O)CCSCc1ccccc1 |
| InChI | InChI=1S/C32H36Cl2N2O2S/c33-28-17-10-18-29(34)27(28)22-36(31(37)19-20-39-23-25-13-6-2-7-14-25)30(21-24-11-4-1-5-12-24)32(38)35-26-15-8-3-9-16-26/h1-2,4-7,10-14,17-18,26,30H,3,8-9,15-16,19-23H2,(H,35,38)/t30-/m1/s1 |
| InChIKey | ZWELRRDKONECRB-SSEXGKCCSA-N |
| XLogP | 7.71 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.63 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|