C32H37ClN2O2S — CID 133177803
2-[3-benzylsulfanylpropanoyl-[(4-chlorophenyl)methyl]amino]-N-cyclohexyl-3-phenylpropanamide (PubChem CID 133177803) has the molecular formula C32H37ClN2O2S and a molecular weight of 549.18 g/mol. Its IUPAC name is 2-[3-benzylsulfanylpropanoyl-[(4-chlorophenyl)methyl]amino]-N-cyclohexyl-3-phenylpropanamide.
| Compound Name | 2-[3-benzylsulfanylpropanoyl-[(4-chlorophenyl)methyl]amino]-N-cyclohexyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133177803 |
| Molecular Formula | C32H37ClN2O2S |
| Molecular Weight | 549.18 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | 2-[3-benzylsulfanylpropanoyl-[(4-chlorophenyl)methyl]amino]-N-cyclohexyl-3-phenylpropanamide |
| SMILES | O=C(NC1CCCCC1)C(Cc1ccccc1)N(Cc1ccc(Cl)cc1)C(=O)CCSCc1ccccc1 |
| InChI | InChI=1S/C32H37ClN2O2S/c33-28-18-16-26(17-19-28)23-35(31(36)20-21-38-24-27-12-6-2-7-13-27)30(22-25-10-4-1-5-11-25)32(37)34-29-14-8-3-9-15-29/h1-2,4-7,10-13,16-19,29-30H,3,8-9,14-15,20-24H2,(H,34,37) |
| InChIKey | ISRSNENIQAZJPU-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.18 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|