C29H31ClN2O2 — CID 100504223
(2S)-2-[(4-chlorophenyl)methyl-(2-phenylacetyl)amino]-N-cyclopentyl-3-phenylpropanamide (PubChem CID 100504223) has the molecular formula C29H31ClN2O2 and a molecular weight of 475.03 g/mol. Its IUPAC name is (2S)-2-[(4-chlorophenyl)methyl-(2-phenylacetyl)amino]-N-cyclopentyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[(4-chlorophenyl)methyl-(2-phenylacetyl)amino]-N-cyclopentyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100504223 |
| Molecular Formula | C29H31ClN2O2 |
| Molecular Weight | 475.03 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | (2S)-2-[(4-chlorophenyl)methyl-(2-phenylacetyl)amino]-N-cyclopentyl-3-phenylpropanamide |
| SMILES | O=C(NC1CCCC1)[C@H](Cc1ccccc1)N(Cc1ccc(Cl)cc1)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C29H31ClN2O2/c30-25-17-15-24(16-18-25)21-32(28(33)20-23-11-5-2-6-12-23)27(19-22-9-3-1-4-10-22)29(34)31-26-13-7-8-14-26/h1-6,9-12,15-18,26-27H,7-8,13-14,19-21H2,(H,31,34)/t27-/m0/s1 |
| InChIKey | JEIMQDSUDNYOHX-MHZLTWQESA-N |
| XLogP | 5.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.03 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |