C29H30Cl2N2O2 — CID 133263656
2-[benzyl-[2-(3,4-dichlorophenyl)acetyl]amino]-N-cyclopentyl-3-phenylpropanamide (PubChem CID 133263656) has the molecular formula C29H30Cl2N2O2 and a molecular weight of 509.48 g/mol. Its IUPAC name is 2-[benzyl-[2-(3,4-dichlorophenyl)acetyl]amino]-N-cyclopentyl-3-phenylpropanamide.
| Compound Name | 2-[benzyl-[2-(3,4-dichlorophenyl)acetyl]amino]-N-cyclopentyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133263656 |
| Molecular Formula | C29H30Cl2N2O2 |
| Molecular Weight | 509.48 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 2-[benzyl-[2-(3,4-dichlorophenyl)acetyl]amino]-N-cyclopentyl-3-phenylpropanamide |
| SMILES | O=C(NC1CCCC1)C(Cc1ccccc1)N(Cc1ccccc1)C(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C29H30Cl2N2O2/c30-25-16-15-23(17-26(25)31)19-28(34)33(20-22-11-5-2-6-12-22)27(18-21-9-3-1-4-10-21)29(35)32-24-13-7-8-14-24/h1-6,9-12,15-17,24,27H,7-8,13-14,18-20H2,(H,32,35) |
| InChIKey | RMBRXPWBNVDALV-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.48 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |