C32H38N2O2S — CID 133175824
2-[benzyl(3-benzylsulfanylpropanoyl)amino]-N-cyclohexyl-3-phenylpropanamide (PubChem CID 133175824) has the molecular formula C32H38N2O2S and a molecular weight of 514.74 g/mol. Its IUPAC name is 2-[benzyl(3-benzylsulfanylpropanoyl)amino]-N-cyclohexyl-3-phenylpropanamide.
| Compound Name | 2-[benzyl(3-benzylsulfanylpropanoyl)amino]-N-cyclohexyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133175824 |
| Molecular Formula | C32H38N2O2S |
| Molecular Weight | 514.74 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 2-[benzyl(3-benzylsulfanylpropanoyl)amino]-N-cyclohexyl-3-phenylpropanamide |
| SMILES | O=C(NC1CCCCC1)C(Cc1ccccc1)N(Cc1ccccc1)C(=O)CCSCc1ccccc1 |
| InChI | InChI=1S/C32H38N2O2S/c35-31(21-22-37-25-28-17-9-3-10-18-28)34(24-27-15-7-2-8-16-27)30(23-26-13-5-1-6-14-26)32(36)33-29-19-11-4-12-20-29/h1-3,5-10,13-18,29-30H,4,11-12,19-25H2,(H,33,36) |
| InChIKey | TWWHSJAZSLWLHC-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.74 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|