C31H36N2O2 — CID 100571887
(2R)-2-[benzyl(3-phenylpropanoyl)amino]-N-cyclohexyl-3-phenylpropanamide (PubChem CID 100571887) has the molecular formula C31H36N2O2 and a molecular weight of 468.64 g/mol. Its IUPAC name is (2R)-2-[benzyl(3-phenylpropanoyl)amino]-N-cyclohexyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[benzyl(3-phenylpropanoyl)amino]-N-cyclohexyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100571887 |
| Molecular Formula | C31H36N2O2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | (2R)-2-[benzyl(3-phenylpropanoyl)amino]-N-cyclohexyl-3-phenylpropanamide |
| SMILES | O=C(NC1CCCCC1)[C@@H](Cc1ccccc1)N(Cc1ccccc1)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C31H36N2O2/c34-30(22-21-25-13-5-1-6-14-25)33(24-27-17-9-3-10-18-27)29(23-26-15-7-2-8-16-26)31(35)32-28-19-11-4-12-20-28/h1-3,5-10,13-18,28-29H,4,11-12,19-24H2,(H,32,35)/t29-/m1/s1 |
| InChIKey | JNDPABPYHUKZJM-GDLZYMKVSA-N |
| XLogP | 5.71 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |