C34H42N2O4 — CID 133263604
2-[benzyl-[3-(3,4-diethoxyphenyl)propanoyl]amino]-N-cyclopentyl-3-phenylpropanamide (PubChem CID 133263604) has the molecular formula C34H42N2O4 and a molecular weight of 542.72 g/mol. Its IUPAC name is 2-[benzyl-[3-(3,4-diethoxyphenyl)propanoyl]amino]-N-cyclopentyl-3-phenylpropanamide.
| Compound Name | 2-[benzyl-[3-(3,4-diethoxyphenyl)propanoyl]amino]-N-cyclopentyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133263604 |
| Molecular Formula | C34H42N2O4 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | 2-[benzyl-[3-(3,4-diethoxyphenyl)propanoyl]amino]-N-cyclopentyl-3-phenylpropanamide |
| SMILES | CCOc1ccc(CCC(=O)N(Cc2ccccc2)C(Cc2ccccc2)C(=O)NC2CCCC2)cc1OCC |
| InChI | InChI=1S/C34H42N2O4/c1-3-39-31-21-19-27(24-32(31)40-4-2)20-22-33(37)36(25-28-15-9-6-10-16-28)30(23-26-13-7-5-8-14-26)34(38)35-29-17-11-12-18-29/h5-10,13-16,19,21,24,29-30H,3-4,11-12,17-18,20,22-23,25H2,1-2H3,(H,35,38) |
| InChIKey | RRMWTMPSBJJMEO-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |