C30H42N2O4 — CID 132618643
2-[benzyl-[3-(3,4-diethoxyphenyl)propanoyl]amino]-N-cyclohexylbutanamide (PubChem CID 132618643) has the molecular formula C30H42N2O4 and a molecular weight of 494.68 g/mol. Its IUPAC name is 2-[benzyl-[3-(3,4-diethoxyphenyl)propanoyl]amino]-N-cyclohexylbutanamide.
| Compound Name | 2-[benzyl-[3-(3,4-diethoxyphenyl)propanoyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 132618643 |
| Molecular Formula | C30H42N2O4 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | 2-[benzyl-[3-(3,4-diethoxyphenyl)propanoyl]amino]-N-cyclohexylbutanamide |
| SMILES | CCOc1ccc(CCC(=O)N(Cc2ccccc2)C(CC)C(=O)NC2CCCCC2)cc1OCC |
| InChI | InChI=1S/C30H42N2O4/c1-4-26(30(34)31-25-15-11-8-12-16-25)32(22-24-13-9-7-10-14-24)29(33)20-18-23-17-19-27(35-5-2)28(21-23)36-6-3/h7,9-10,13-14,17,19,21,25-26H,4-6,8,11-12,15-16,18,20,22H2,1-3H3,(H,31,34) |
| InChIKey | PPPNGSLJPJHFPR-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |