C28H38N2O4 — CID 100527518
(2R)-2-[benzyl-[3-(3,4-dimethoxyphenyl)propanoyl]amino]-N-cyclohexylbutanamide (PubChem CID 100527518) has the molecular formula C28H38N2O4 and a molecular weight of 466.62 g/mol. Its IUPAC name is (2R)-2-[benzyl-[3-(3,4-dimethoxyphenyl)propanoyl]amino]-N-cyclohexylbutanamide.
| Compound Name | (2R)-2-[benzyl-[3-(3,4-dimethoxyphenyl)propanoyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 100527518 |
| Molecular Formula | C28H38N2O4 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | (2R)-2-[benzyl-[3-(3,4-dimethoxyphenyl)propanoyl]amino]-N-cyclohexylbutanamide |
| SMILES | CC[C@H](C(=O)NC1CCCCC1)N(Cc1ccccc1)C(=O)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C28H38N2O4/c1-4-24(28(32)29-23-13-9-6-10-14-23)30(20-22-11-7-5-8-12-22)27(31)18-16-21-15-17-25(33-2)26(19-21)34-3/h5,7-8,11-12,15,17,19,23-24H,4,6,9-10,13-14,16,18,20H2,1-3H3,(H,29,32)/t24-/m1/s1 |
| InChIKey | JOQACDVUQCCRQH-XMMPIXPASA-N |
| XLogP | 4.89 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |