C27H36N2O4 — CID 132613155
N-cyclopentyl-2-[3-(3,4-dimethoxyphenyl)propanoyl-(2-phenylethyl)amino]propanamide (PubChem CID 132613155) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is N-cyclopentyl-2-[3-(3,4-dimethoxyphenyl)propanoyl-(2-phenylethyl)amino]propanamide.
| Compound Name | N-cyclopentyl-2-[3-(3,4-dimethoxyphenyl)propanoyl-(2-phenylethyl)amino]propanamide |
|---|---|
| PubChem CID | 132613155 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | N-cyclopentyl-2-[3-(3,4-dimethoxyphenyl)propanoyl-(2-phenylethyl)amino]propanamide |
| SMILES | COc1ccc(CCC(=O)N(CCc2ccccc2)C(C)C(=O)NC2CCCC2)cc1OC |
| InChI | InChI=1S/C27H36N2O4/c1-20(27(31)28-23-11-7-8-12-23)29(18-17-21-9-5-4-6-10-21)26(30)16-14-22-13-15-24(32-2)25(19-22)33-3/h4-6,9-10,13,15,19-20,23H,7-8,11-12,14,16-18H2,1-3H3,(H,28,31) |
| InChIKey | CZELTYCXFUEZFO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |