C28H40N2O4 — CID 132721965
2-[benzyl-[3-(3,4-diethoxyphenyl)propanoyl]amino]-N-butan-2-ylbutanamide (PubChem CID 132721965) has the molecular formula C28H40N2O4 and a molecular weight of 468.64 g/mol. Its IUPAC name is 2-[benzyl-[3-(3,4-diethoxyphenyl)propanoyl]amino]-N-butan-2-ylbutanamide.
| Compound Name | 2-[benzyl-[3-(3,4-diethoxyphenyl)propanoyl]amino]-N-butan-2-ylbutanamide |
|---|---|
| PubChem CID | 132721965 |
| Molecular Formula | C28H40N2O4 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | 2-[benzyl-[3-(3,4-diethoxyphenyl)propanoyl]amino]-N-butan-2-ylbutanamide |
| SMILES | CCOc1ccc(CCC(=O)N(Cc2ccccc2)C(CC)C(=O)NC(C)CC)cc1OCC |
| InChI | InChI=1S/C28H40N2O4/c1-6-21(5)29-28(32)24(7-2)30(20-23-13-11-10-12-14-23)27(31)18-16-22-15-17-25(33-8-3)26(19-22)34-9-4/h10-15,17,19,21,24H,6-9,16,18,20H2,1-5H3,(H,29,32) |
| InChIKey | GFQLZAIYUKYWGK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |