C27H34Cl2N2O2S — CID 100580711
(2S)-2-[3-benzylsulfanylpropanoyl-[(3,4-dichlorophenyl)methyl]amino]-N-cyclohexylbutanamide (PubChem CID 100580711) has the molecular formula C27H34Cl2N2O2S and a molecular weight of 521.55 g/mol. Its IUPAC name is (2S)-2-[3-benzylsulfanylpropanoyl-[(3,4-dichlorophenyl)methyl]amino]-N-cyclohexylbutanamide.
| Compound Name | (2S)-2-[3-benzylsulfanylpropanoyl-[(3,4-dichlorophenyl)methyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 100580711 |
| Molecular Formula | C27H34Cl2N2O2S |
| Molecular Weight | 521.55 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | (2S)-2-[3-benzylsulfanylpropanoyl-[(3,4-dichlorophenyl)methyl]amino]-N-cyclohexylbutanamide |
| SMILES | CC[C@@H](C(=O)NC1CCCCC1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CCSCc1ccccc1 |
| InChI | InChI=1S/C27H34Cl2N2O2S/c1-2-25(27(33)30-22-11-7-4-8-12-22)31(18-21-13-14-23(28)24(29)17-21)26(32)15-16-34-19-20-9-5-3-6-10-20/h3,5-6,9-10,13-14,17,22,25H,2,4,7-8,11-12,15-16,18-19H2,1H3,(H,30,33)/t25-/m0/s1 |
| InChIKey | KWSUCURFABLHCC-VWLOTQADSA-N |
| XLogP | 6.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.55 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|