C26H31Cl2N3O4S — CID 100576234
(2S)-N-cyclohexyl-2-[(3,4-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]butanamide (PubChem CID 100576234) has the molecular formula C26H31Cl2N3O4S and a molecular weight of 552.52 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-[(3,4-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]butanamide.
| Compound Name | (2S)-N-cyclohexyl-2-[(3,4-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]butanamide |
|---|---|
| PubChem CID | 100576234 |
| Molecular Formula | C26H31Cl2N3O4S |
| Molecular Weight | 552.52 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | (2S)-N-cyclohexyl-2-[(3,4-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]butanamide |
| SMILES | CC[C@@H](C(=O)NC1CCCCC1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CSCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H31Cl2N3O4S/c1-2-24(26(33)29-20-6-4-3-5-7-20)30(15-19-10-13-22(27)23(28)14-19)25(32)17-36-16-18-8-11-21(12-9-18)31(34)35/h8-14,20,24H,2-7,15-17H2,1H3,(H,29,33)/t24-/m0/s1 |
| InChIKey | MWVMWAWEXLQVDN-DEOSSOPVSA-N |
| XLogP | 6.39 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.52 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|