C23H27Cl2N3O4S — CID 132681913
2-[(3,4-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-propylbutanamide (PubChem CID 132681913) has the molecular formula C23H27Cl2N3O4S and a molecular weight of 512.46 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-propylbutanamide.
| Compound Name | 2-[(3,4-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-propylbutanamide |
|---|---|
| PubChem CID | 132681913 |
| Molecular Formula | C23H27Cl2N3O4S |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-propylbutanamide |
| SMILES | CCCNC(=O)C(CC)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CSCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H27Cl2N3O4S/c1-3-11-26-23(30)21(4-2)27(13-17-7-10-19(24)20(25)12-17)22(29)15-33-14-16-5-8-18(9-6-16)28(31)32/h5-10,12,21H,3-4,11,13-15H2,1-2H3,(H,26,30) |
| InChIKey | FDLPRKFNTIJJPB-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|