C22H25Cl2N3O4S — CID 132679768
2-[(2,4-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-propylpropanamide (PubChem CID 132679768) has the molecular formula C22H25Cl2N3O4S and a molecular weight of 498.43 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-propylpropanamide.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 132679768 |
| Molecular Formula | C22H25Cl2N3O4S |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)N(Cc1ccc(Cl)cc1Cl)C(=O)CSCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H25Cl2N3O4S/c1-3-10-25-22(29)15(2)26(12-17-6-7-18(23)11-20(17)24)21(28)14-32-13-16-4-8-19(9-5-16)27(30)31/h4-9,11,15H,3,10,12-14H2,1-2H3,(H,25,29) |
| InChIKey | WCYYSNPJBNAXBD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|