C23H27Cl2N3O4S — CID 100576446
(2S)-N-[(2S)-butan-2-yl]-2-[(2,4-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]propanamide (PubChem CID 100576446) has the molecular formula C23H27Cl2N3O4S and a molecular weight of 512.46 g/mol. Its IUPAC name is (2S)-N-[(2S)-butan-2-yl]-2-[(2,4-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]propanamide.
| Compound Name | (2S)-N-[(2S)-butan-2-yl]-2-[(2,4-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]propanamide |
|---|---|
| PubChem CID | 100576446 |
| Molecular Formula | C23H27Cl2N3O4S |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | (2S)-N-[(2S)-butan-2-yl]-2-[(2,4-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]propanamide |
| SMILES | CC[C@H](C)NC(=O)[C@H](C)N(Cc1ccc(Cl)cc1Cl)C(=O)CSCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H27Cl2N3O4S/c1-4-15(2)26-23(30)16(3)27(12-18-7-8-19(24)11-21(18)25)22(29)14-33-13-17-5-9-20(10-6-17)28(31)32/h5-11,15-16H,4,12-14H2,1-3H3,(H,26,30)/t15-,16-/m0/s1 |
| InChIKey | PUKMRKAFGHXWPN-HOTGVXAUSA-N |
| XLogP | 5.47 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|