C29H31Cl2N3O4S — CID 133206666
N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-3-phenylpropanamide (PubChem CID 133206666) has the molecular formula C29H31Cl2N3O4S and a molecular weight of 588.56 g/mol. Its IUPAC name is N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133206666 |
| Molecular Formula | C29H31Cl2N3O4S |
| Molecular Weight | 588.56 g/mol |
| Exact Mass | 587.14 |
| IUPAC Name | N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)cc1Cl)C(=O)CSCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H31Cl2N3O4S/c1-2-3-15-32-29(36)27(16-21-7-5-4-6-8-21)33(18-23-11-12-24(30)17-26(23)31)28(35)20-39-19-22-9-13-25(14-10-22)34(37)38/h4-14,17,27H,2-3,15-16,18-20H2,1H3,(H,32,36) |
| InChIKey | LZHYXACCIHYEMV-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.56 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|