C29H32BrN3O4S — CID 133206325
2-[(4-bromophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 133206325) has the molecular formula C29H32BrN3O4S and a molecular weight of 598.56 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | 2-[(4-bromophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133206325 |
| Molecular Formula | C29H32BrN3O4S |
| Molecular Weight | 598.56 g/mol |
| Exact Mass | 597.13 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Br)cc1)C(=O)CSCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H32BrN3O4S/c1-2-3-17-31-29(35)27(18-22-7-5-4-6-8-22)32(19-23-9-13-25(30)14-10-23)28(34)21-38-20-24-11-15-26(16-12-24)33(36)37/h4-16,27H,2-3,17-21H2,1H3,(H,31,35) |
| InChIKey | JTFHUJUGHKHUMJ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.56 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|