C28H29Cl2N3O4S — CID 133256227
2-[(2,6-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-3-phenyl-N-propylpropanamide (PubChem CID 133256227) has the molecular formula C28H29Cl2N3O4S and a molecular weight of 574.53 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-3-phenyl-N-propylpropanamide.
| Compound Name | 2-[(2,6-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-3-phenyl-N-propylpropanamide |
|---|---|
| PubChem CID | 133256227 |
| Molecular Formula | C28H29Cl2N3O4S |
| Molecular Weight | 574.53 g/mol |
| Exact Mass | 573.13 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-3-phenyl-N-propylpropanamide |
| SMILES | CCCNC(=O)C(Cc1ccccc1)N(Cc1c(Cl)cccc1Cl)C(=O)CSCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H29Cl2N3O4S/c1-2-15-31-28(35)26(16-20-7-4-3-5-8-20)32(17-23-24(29)9-6-10-25(23)30)27(34)19-38-18-21-11-13-22(14-12-21)33(36)37/h3-14,26H,2,15-19H2,1H3,(H,31,35) |
| InChIKey | MUUSSHKSGBFDIR-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.53 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|