C21H23Cl2N3O4S — CID 132677604
2-[(2,6-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-ethylpropanamide (PubChem CID 132677604) has the molecular formula C21H23Cl2N3O4S and a molecular weight of 484.41 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-ethylpropanamide.
| Compound Name | 2-[(2,6-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 132677604 |
| Molecular Formula | C21H23Cl2N3O4S |
| Molecular Weight | 484.41 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)N(Cc1c(Cl)cccc1Cl)C(=O)CSCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H23Cl2N3O4S/c1-3-24-21(28)14(2)25(11-17-18(22)5-4-6-19(17)23)20(27)13-31-12-15-7-9-16(10-8-15)26(29)30/h4-10,14H,3,11-13H2,1-2H3,(H,24,28) |
| InChIKey | ZMGQZERBWWSFBU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|