C24H29Cl2N3O4S — CID 132732783
N-butan-2-yl-2-[(3,4-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]butanamide (PubChem CID 132732783) has the molecular formula C24H29Cl2N3O4S and a molecular weight of 526.49 g/mol. Its IUPAC name is N-butan-2-yl-2-[(3,4-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]butanamide.
| Compound Name | N-butan-2-yl-2-[(3,4-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]butanamide |
|---|---|
| PubChem CID | 132732783 |
| Molecular Formula | C24H29Cl2N3O4S |
| Molecular Weight | 526.49 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | N-butan-2-yl-2-[(3,4-dichlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]butanamide |
| SMILES | CCC(C)NC(=O)C(CC)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CSCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H29Cl2N3O4S/c1-4-16(3)27-24(31)22(5-2)28(13-18-8-11-20(25)21(26)12-18)23(30)15-34-14-17-6-9-19(10-7-17)29(32)33/h6-12,16,22H,4-5,13-15H2,1-3H3,(H,27,31) |
| InChIKey | GIGLOLYAAZCYFX-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.49 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|