C17H24Cl2N2O2 — CID 100596073
(2R)-2-[(3,4-dichlorophenyl)methyl-propanoylamino]-N-propylbutanamide (PubChem CID 100596073) has the molecular formula C17H24Cl2N2O2 and a molecular weight of 359.30 g/mol. Its IUPAC name is (2R)-2-[(3,4-dichlorophenyl)methyl-propanoylamino]-N-propylbutanamide.
| Compound Name | (2R)-2-[(3,4-dichlorophenyl)methyl-propanoylamino]-N-propylbutanamide |
|---|---|
| PubChem CID | 100596073 |
| Molecular Formula | C17H24Cl2N2O2 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | (2R)-2-[(3,4-dichlorophenyl)methyl-propanoylamino]-N-propylbutanamide |
| SMILES | CCCNC(=O)[C@@H](CC)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CC |
| InChI | InChI=1S/C17H24Cl2N2O2/c1-4-9-20-17(23)15(5-2)21(16(22)6-3)11-12-7-8-13(18)14(19)10-12/h7-8,10,15H,4-6,9,11H2,1-3H3,(H,20,23)/t15-/m1/s1 |
| InChIKey | ZLFBIXFZTNRZSR-OAHLLOKOSA-N |
| XLogP | 4.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |