C22H26Cl2N2O3 — CID 100589803
(2S)-2-[(3,4-dichlorophenyl)methyl-(2-phenoxyacetyl)amino]-N-propylbutanamide (PubChem CID 100589803) has the molecular formula C22H26Cl2N2O3 and a molecular weight of 437.37 g/mol. Its IUPAC name is (2S)-2-[(3,4-dichlorophenyl)methyl-(2-phenoxyacetyl)amino]-N-propylbutanamide.
| Compound Name | (2S)-2-[(3,4-dichlorophenyl)methyl-(2-phenoxyacetyl)amino]-N-propylbutanamide |
|---|---|
| PubChem CID | 100589803 |
| Molecular Formula | C22H26Cl2N2O3 |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | (2S)-2-[(3,4-dichlorophenyl)methyl-(2-phenoxyacetyl)amino]-N-propylbutanamide |
| SMILES | CCCNC(=O)[C@H](CC)N(Cc1ccc(Cl)c(Cl)c1)C(=O)COc1ccccc1 |
| InChI | InChI=1S/C22H26Cl2N2O3/c1-3-12-25-22(28)20(4-2)26(14-16-10-11-18(23)19(24)13-16)21(27)15-29-17-8-6-5-7-9-17/h5-11,13,20H,3-4,12,14-15H2,1-2H3,(H,25,28)/t20-/m0/s1 |
| InChIKey | KDDNUNIPVAABIG-FQEVSTJZSA-N |
| XLogP | 4.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |