C26H33N3O4S — CID 132617272
N-cyclopentyl-2-[(2-methylphenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]butanamide (PubChem CID 132617272) has the molecular formula C26H33N3O4S and a molecular weight of 483.63 g/mol. Its IUPAC name is N-cyclopentyl-2-[(2-methylphenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]butanamide.
| Compound Name | N-cyclopentyl-2-[(2-methylphenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]butanamide |
|---|---|
| PubChem CID | 132617272 |
| Molecular Formula | C26H33N3O4S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | N-cyclopentyl-2-[(2-methylphenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]butanamide |
| SMILES | CCC(C(=O)NC1CCCC1)N(Cc1ccccc1C)C(=O)CSCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H33N3O4S/c1-3-24(26(31)27-22-10-6-7-11-22)28(16-21-9-5-4-8-19(21)2)25(30)18-34-17-20-12-14-23(15-13-20)29(32)33/h4-5,8-9,12-15,22,24H,3,6-7,10-11,16-18H2,1-2H3,(H,27,31) |
| InChIKey | WWKZDRWQWAXICI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|