C31H35N3O4S — CID 133264356
N-cyclopentyl-2-[(4-methylphenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-3-phenylpropanamide (PubChem CID 133264356) has the molecular formula C31H35N3O4S and a molecular weight of 545.71 g/mol. Its IUPAC name is N-cyclopentyl-2-[(4-methylphenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-3-phenylpropanamide.
| Compound Name | N-cyclopentyl-2-[(4-methylphenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133264356 |
| Molecular Formula | C31H35N3O4S |
| Molecular Weight | 545.71 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | N-cyclopentyl-2-[(4-methylphenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-3-phenylpropanamide |
| SMILES | Cc1ccc(CN(C(=O)CSCc2ccc([N+](=O)[O-])cc2)C(Cc2ccccc2)C(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C31H35N3O4S/c1-23-11-13-25(14-12-23)20-33(30(35)22-39-21-26-15-17-28(18-16-26)34(37)38)29(19-24-7-3-2-4-8-24)31(36)32-27-9-5-6-10-27/h2-4,7-8,11-18,27,29H,5-6,9-10,19-22H2,1H3,(H,32,36) |
| InChIKey | ZJKLXPDNTMKXTR-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.71 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|