C31H35N3O5S — CID 133261289
N-cyclopentyl-2-[(3-methoxyphenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-3-phenylpropanamide (PubChem CID 133261289) has the molecular formula C31H35N3O5S and a molecular weight of 561.70 g/mol. Its IUPAC name is N-cyclopentyl-2-[(3-methoxyphenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-3-phenylpropanamide.
| Compound Name | N-cyclopentyl-2-[(3-methoxyphenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133261289 |
| Molecular Formula | C31H35N3O5S |
| Molecular Weight | 561.70 g/mol |
| Exact Mass | 561.23 |
| IUPAC Name | N-cyclopentyl-2-[(3-methoxyphenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-3-phenylpropanamide |
| SMILES | COc1cccc(CN(C(=O)CSCc2ccc([N+](=O)[O-])cc2)C(Cc2ccccc2)C(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C31H35N3O5S/c1-39-28-13-7-10-25(18-28)20-33(30(35)22-40-21-24-14-16-27(17-15-24)34(37)38)29(19-23-8-3-2-4-9-23)31(36)32-26-11-5-6-12-26/h2-4,7-10,13-18,26,29H,5-6,11-12,19-22H2,1H3,(H,32,36) |
| InChIKey | NBAWRSQXGWKUFQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.70 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|