C28H30BrN3O4S — CID 100518078
(2S)-2-[(3-bromophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-3-phenyl-N-propan-2-ylpropanamide (PubChem CID 100518078) has the molecular formula C28H30BrN3O4S and a molecular weight of 584.54 g/mol. Its IUPAC name is (2S)-2-[(3-bromophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-3-phenyl-N-propan-2-ylpropanamide.
| Compound Name | (2S)-2-[(3-bromophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-3-phenyl-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 100518078 |
| Molecular Formula | C28H30BrN3O4S |
| Molecular Weight | 584.54 g/mol |
| Exact Mass | 583.11 |
| IUPAC Name | (2S)-2-[(3-bromophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-3-phenyl-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)[C@H](Cc1ccccc1)N(Cc1cccc(Br)c1)C(=O)CSCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H30BrN3O4S/c1-20(2)30-28(34)26(16-21-7-4-3-5-8-21)31(17-23-9-6-10-24(29)15-23)27(33)19-37-18-22-11-13-25(14-12-22)32(35)36/h3-15,20,26H,16-19H2,1-2H3,(H,30,34)/t26-/m0/s1 |
| InChIKey | FWUMGQLKARCRJE-SANMLTNESA-N |
| XLogP | 5.76 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.54 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|