C24H28BrN3O4S — CID 133198808
2-[(3-bromophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-cyclopentylpropanamide (PubChem CID 133198808) has the molecular formula C24H28BrN3O4S and a molecular weight of 534.48 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-cyclopentylpropanamide.
| Compound Name | 2-[(3-bromophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 133198808 |
| Molecular Formula | C24H28BrN3O4S |
| Molecular Weight | 534.48 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | 2-[(3-bromophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-cyclopentylpropanamide |
| SMILES | CC(C(=O)NC1CCCC1)N(Cc1cccc(Br)c1)C(=O)CSCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H28BrN3O4S/c1-17(24(30)26-21-7-2-3-8-21)27(14-19-5-4-6-20(25)13-19)23(29)16-33-15-18-9-11-22(12-10-18)28(31)32/h4-6,9-13,17,21H,2-3,7-8,14-16H2,1H3,(H,26,30) |
| InChIKey | QQJNSAMAHIURNL-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|