C30H32ClN3O4S — CID 133247853
2-[(3-chlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-cyclopentyl-3-phenylpropanamide (PubChem CID 133247853) has the molecular formula C30H32ClN3O4S and a molecular weight of 566.12 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-cyclopentyl-3-phenylpropanamide.
| Compound Name | 2-[(3-chlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-cyclopentyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133247853 |
| Molecular Formula | C30H32ClN3O4S |
| Molecular Weight | 566.12 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-cyclopentyl-3-phenylpropanamide |
| SMILES | O=C(NC1CCCC1)C(Cc1ccccc1)N(Cc1cccc(Cl)c1)C(=O)CSCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H32ClN3O4S/c31-25-10-6-9-24(17-25)19-33(29(35)21-39-20-23-13-15-27(16-14-23)34(37)38)28(18-22-7-2-1-3-8-22)30(36)32-26-11-4-5-12-26/h1-3,6-10,13-17,26,28H,4-5,11-12,18-21H2,(H,32,36) |
| InChIKey | ORWIRTPQSYTACE-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.12 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|