C20H28Cl2N2O2 — CID 132763541
2-[butanoyl-[(3,4-dichlorophenyl)methyl]amino]-N-cyclopentylbutanamide (PubChem CID 132763541) has the molecular formula C20H28Cl2N2O2 and a molecular weight of 399.36 g/mol. Its IUPAC name is 2-[butanoyl-[(3,4-dichlorophenyl)methyl]amino]-N-cyclopentylbutanamide.
| Compound Name | 2-[butanoyl-[(3,4-dichlorophenyl)methyl]amino]-N-cyclopentylbutanamide |
|---|---|
| PubChem CID | 132763541 |
| Molecular Formula | C20H28Cl2N2O2 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 2-[butanoyl-[(3,4-dichlorophenyl)methyl]amino]-N-cyclopentylbutanamide |
| SMILES | CCCC(=O)N(Cc1ccc(Cl)c(Cl)c1)C(CC)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C20H28Cl2N2O2/c1-3-7-19(25)24(13-14-10-11-16(21)17(22)12-14)18(4-2)20(26)23-15-8-5-6-9-15/h10-12,15,18H,3-9,13H2,1-2H3,(H,23,26) |
| InChIKey | OUQFFEHKIQAFCJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |