C33H40N2O3 — CID 100579109
N-[(2S)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2-methylphenyl)methyl]-4-phenoxybutanamide (PubChem CID 100579109) has the molecular formula C33H40N2O3 and a molecular weight of 512.69 g/mol. Its IUPAC name is N-[(2S)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2-methylphenyl)methyl]-4-phenoxybutanamide.
| Compound Name | N-[(2S)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2-methylphenyl)methyl]-4-phenoxybutanamide |
|---|---|
| PubChem CID | 100579109 |
| Molecular Formula | C33H40N2O3 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | N-[(2S)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2-methylphenyl)methyl]-4-phenoxybutanamide |
| SMILES | Cc1ccccc1CN(C(=O)CCCOc1ccccc1)[C@@H](Cc1ccccc1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C33H40N2O3/c1-26-14-11-12-17-28(26)25-35(32(36)22-13-23-38-30-20-9-4-10-21-30)31(24-27-15-5-2-6-16-27)33(37)34-29-18-7-3-8-19-29/h2,4-6,9-12,14-17,20-21,29,31H,3,7-8,13,18-19,22-25H2,1H3,(H,34,37)/t31-/m0/s1 |
| InChIKey | FKBQDUWEJQNMHB-HKBQPEDESA-N |
| XLogP | 6.24 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|