C34H42N2O4 — CID 100579163
N-[(2S)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-methoxyphenoxy)-N-[(2-methylphenyl)methyl]butanamide (PubChem CID 100579163) has the molecular formula C34H42N2O4 and a molecular weight of 542.72 g/mol. Its IUPAC name is N-[(2S)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-methoxyphenoxy)-N-[(2-methylphenyl)methyl]butanamide.
| Compound Name | N-[(2S)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-methoxyphenoxy)-N-[(2-methylphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 100579163 |
| Molecular Formula | C34H42N2O4 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | N-[(2S)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-methoxyphenoxy)-N-[(2-methylphenyl)methyl]butanamide |
| SMILES | COc1ccc(OCCCC(=O)N(Cc2ccccc2C)[C@@H](Cc2ccccc2)C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C34H42N2O4/c1-26-12-9-10-15-28(26)25-36(33(37)18-11-23-40-31-21-19-30(39-2)20-22-31)32(24-27-13-5-3-6-14-27)34(38)35-29-16-7-4-8-17-29/h3,5-6,9-10,12-15,19-22,29,32H,4,7-8,11,16-18,23-25H2,1-2H3,(H,35,38)/t32-/m0/s1 |
| InChIKey | BRVKOJPCPDNDFO-YTTGMZPUSA-N |
| XLogP | 6.25 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|