C28H38N2O4 — CID 132614951
2-[benzyl-[4-(4-methoxyphenoxy)butanoyl]amino]-N-cyclohexylbutanamide (PubChem CID 132614951) has the molecular formula C28H38N2O4 and a molecular weight of 466.62 g/mol. Its IUPAC name is 2-[benzyl-[4-(4-methoxyphenoxy)butanoyl]amino]-N-cyclohexylbutanamide.
| Compound Name | 2-[benzyl-[4-(4-methoxyphenoxy)butanoyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 132614951 |
| Molecular Formula | C28H38N2O4 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | 2-[benzyl-[4-(4-methoxyphenoxy)butanoyl]amino]-N-cyclohexylbutanamide |
| SMILES | CCC(C(=O)NC1CCCCC1)N(Cc1ccccc1)C(=O)CCCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C28H38N2O4/c1-3-26(28(32)29-23-13-8-5-9-14-23)30(21-22-11-6-4-7-12-22)27(31)15-10-20-34-25-18-16-24(33-2)17-19-25/h4,6-7,11-12,16-19,23,26H,3,5,8-10,13-15,20-21H2,1-2H3,(H,29,32) |
| InChIKey | UDXKAKDMOPREJX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|