C29H40N2O3 — CID 100606400
(2R)-N-cyclohexyl-2-[4-(4-methylphenoxy)butanoyl-(2-phenylethyl)amino]butanamide (PubChem CID 100606400) has the molecular formula C29H40N2O3 and a molecular weight of 464.65 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-[4-(4-methylphenoxy)butanoyl-(2-phenylethyl)amino]butanamide.
| Compound Name | (2R)-N-cyclohexyl-2-[4-(4-methylphenoxy)butanoyl-(2-phenylethyl)amino]butanamide |
|---|---|
| PubChem CID | 100606400 |
| Molecular Formula | C29H40N2O3 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | (2R)-N-cyclohexyl-2-[4-(4-methylphenoxy)butanoyl-(2-phenylethyl)amino]butanamide |
| SMILES | CC[C@H](C(=O)NC1CCCCC1)N(CCc1ccccc1)C(=O)CCCOc1ccc(C)cc1 |
| InChI | InChI=1S/C29H40N2O3/c1-3-27(29(33)30-25-13-8-5-9-14-25)31(21-20-24-11-6-4-7-12-24)28(32)15-10-22-34-26-18-16-23(2)17-19-26/h4,6-7,11-12,16-19,25,27H,3,5,8-10,13-15,20-22H2,1-2H3,(H,30,33)/t27-/m1/s1 |
| InChIKey | QVDHQOWIFWFLRA-HHHXNRCGSA-N |
| XLogP | 5.45 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|