C28H36Cl2N2O3 — CID 100586413
(2S)-N-cyclohexyl-2-[(2,6-dichlorophenyl)methyl-[4-(4-methylphenoxy)butanoyl]amino]butanamide (PubChem CID 100586413) has the molecular formula C28H36Cl2N2O3 and a molecular weight of 519.51 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-[(2,6-dichlorophenyl)methyl-[4-(4-methylphenoxy)butanoyl]amino]butanamide.
| Compound Name | (2S)-N-cyclohexyl-2-[(2,6-dichlorophenyl)methyl-[4-(4-methylphenoxy)butanoyl]amino]butanamide |
|---|---|
| PubChem CID | 100586413 |
| Molecular Formula | C28H36Cl2N2O3 |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | (2S)-N-cyclohexyl-2-[(2,6-dichlorophenyl)methyl-[4-(4-methylphenoxy)butanoyl]amino]butanamide |
| SMILES | CC[C@@H](C(=O)NC1CCCCC1)N(Cc1c(Cl)cccc1Cl)C(=O)CCCOc1ccc(C)cc1 |
| InChI | InChI=1S/C28H36Cl2N2O3/c1-3-26(28(34)31-21-9-5-4-6-10-21)32(19-23-24(29)11-7-12-25(23)30)27(33)13-8-18-35-22-16-14-20(2)15-17-22/h7,11-12,14-17,21,26H,3-6,8-10,13,18-19H2,1-2H3,(H,31,34)/t26-/m0/s1 |
| InChIKey | KIFULMBBKFUBDN-SANMLTNESA-N |
| XLogP | 6.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|