C26H34Cl2N2O3 — CID 132945433
N-butan-2-yl-2-[(2,6-dichlorophenyl)methyl-[4-(4-methylphenoxy)butanoyl]amino]butanamide (PubChem CID 132945433) has the molecular formula C26H34Cl2N2O3 and a molecular weight of 493.48 g/mol. Its IUPAC name is N-butan-2-yl-2-[(2,6-dichlorophenyl)methyl-[4-(4-methylphenoxy)butanoyl]amino]butanamide.
| Compound Name | N-butan-2-yl-2-[(2,6-dichlorophenyl)methyl-[4-(4-methylphenoxy)butanoyl]amino]butanamide |
|---|---|
| PubChem CID | 132945433 |
| Molecular Formula | C26H34Cl2N2O3 |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | N-butan-2-yl-2-[(2,6-dichlorophenyl)methyl-[4-(4-methylphenoxy)butanoyl]amino]butanamide |
| SMILES | CCC(C)NC(=O)C(CC)N(Cc1c(Cl)cccc1Cl)C(=O)CCCOc1ccc(C)cc1 |
| InChI | InChI=1S/C26H34Cl2N2O3/c1-5-19(4)29-26(32)24(6-2)30(17-21-22(27)9-7-10-23(21)28)25(31)11-8-16-33-20-14-12-18(3)13-15-20/h7,9-10,12-15,19,24H,5-6,8,11,16-17H2,1-4H3,(H,29,32) |
| InChIKey | UZWSDGZOLZATHD-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|