C27H35ClN2O3 — CID 132615589
2-[(2-chlorophenyl)methyl-[4-(4-methylphenoxy)butanoyl]amino]-N-cyclopentylbutanamide (PubChem CID 132615589) has the molecular formula C27H35ClN2O3 and a molecular weight of 471.04 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-[4-(4-methylphenoxy)butanoyl]amino]-N-cyclopentylbutanamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-[4-(4-methylphenoxy)butanoyl]amino]-N-cyclopentylbutanamide |
|---|---|
| PubChem CID | 132615589 |
| Molecular Formula | C27H35ClN2O3 |
| Molecular Weight | 471.04 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-[4-(4-methylphenoxy)butanoyl]amino]-N-cyclopentylbutanamide |
| SMILES | CCC(C(=O)NC1CCCC1)N(Cc1ccccc1Cl)C(=O)CCCOc1ccc(C)cc1 |
| InChI | InChI=1S/C27H35ClN2O3/c1-3-25(27(32)29-22-10-5-6-11-22)30(19-21-9-4-7-12-24(21)28)26(31)13-8-18-33-23-16-14-20(2)15-17-23/h4,7,9,12,14-17,22,25H,3,5-6,8,10-11,13,18-19H2,1-2H3,(H,29,32) |
| InChIKey | VRVHMGXBPKTMIM-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.04 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|