C28H36Cl2N2O4 — CID 100573867
(2S)-N-cyclohexyl-2-[(2,4-dichlorophenyl)methyl-[4-(4-methoxyphenoxy)butanoyl]amino]butanamide (PubChem CID 100573867) has the molecular formula C28H36Cl2N2O4 and a molecular weight of 535.51 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-[(2,4-dichlorophenyl)methyl-[4-(4-methoxyphenoxy)butanoyl]amino]butanamide.
| Compound Name | (2S)-N-cyclohexyl-2-[(2,4-dichlorophenyl)methyl-[4-(4-methoxyphenoxy)butanoyl]amino]butanamide |
|---|---|
| PubChem CID | 100573867 |
| Molecular Formula | C28H36Cl2N2O4 |
| Molecular Weight | 535.51 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | (2S)-N-cyclohexyl-2-[(2,4-dichlorophenyl)methyl-[4-(4-methoxyphenoxy)butanoyl]amino]butanamide |
| SMILES | CC[C@@H](C(=O)NC1CCCCC1)N(Cc1ccc(Cl)cc1Cl)C(=O)CCCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C28H36Cl2N2O4/c1-3-26(28(34)31-22-8-5-4-6-9-22)32(19-20-11-12-21(29)18-25(20)30)27(33)10-7-17-36-24-15-13-23(35-2)14-16-24/h11-16,18,22,26H,3-10,17,19H2,1-2H3,(H,31,34)/t26-/m0/s1 |
| InChIKey | PRXUUEJVQFAVOD-SANMLTNESA-N |
| XLogP | 6.42 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.51 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|