C27H34Cl2N2O3 — CID 100560334
(2R)-2-[4-(4-chlorophenoxy)butanoyl-[(4-chlorophenyl)methyl]amino]-N-cyclohexylbutanamide (PubChem CID 100560334) has the molecular formula C27H34Cl2N2O3 and a molecular weight of 505.49 g/mol. Its IUPAC name is (2R)-2-[4-(4-chlorophenoxy)butanoyl-[(4-chlorophenyl)methyl]amino]-N-cyclohexylbutanamide.
| Compound Name | (2R)-2-[4-(4-chlorophenoxy)butanoyl-[(4-chlorophenyl)methyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 100560334 |
| Molecular Formula | C27H34Cl2N2O3 |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | (2R)-2-[4-(4-chlorophenoxy)butanoyl-[(4-chlorophenyl)methyl]amino]-N-cyclohexylbutanamide |
| SMILES | CC[C@H](C(=O)NC1CCCCC1)N(Cc1ccc(Cl)cc1)C(=O)CCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H34Cl2N2O3/c1-2-25(27(33)30-23-7-4-3-5-8-23)31(19-20-10-12-21(28)13-11-20)26(32)9-6-18-34-24-16-14-22(29)15-17-24/h10-17,23,25H,2-9,18-19H2,1H3,(H,30,33)/t25-/m1/s1 |
| InChIKey | WCRYFXSVMIVLHV-RUZDIDTESA-N |
| XLogP | 6.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|