C27H35ClN2O4 — CID 132617662
2-[4-(4-chlorophenoxy)butanoyl-[(4-methoxyphenyl)methyl]amino]-N-cyclopentylbutanamide (PubChem CID 132617662) has the molecular formula C27H35ClN2O4 and a molecular weight of 487.04 g/mol. Its IUPAC name is 2-[4-(4-chlorophenoxy)butanoyl-[(4-methoxyphenyl)methyl]amino]-N-cyclopentylbutanamide.
| Compound Name | 2-[4-(4-chlorophenoxy)butanoyl-[(4-methoxyphenyl)methyl]amino]-N-cyclopentylbutanamide |
|---|---|
| PubChem CID | 132617662 |
| Molecular Formula | C27H35ClN2O4 |
| Molecular Weight | 487.04 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 2-[4-(4-chlorophenoxy)butanoyl-[(4-methoxyphenyl)methyl]amino]-N-cyclopentylbutanamide |
| SMILES | CCC(C(=O)NC1CCCC1)N(Cc1ccc(OC)cc1)C(=O)CCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H35ClN2O4/c1-3-25(27(32)29-22-7-4-5-8-22)30(19-20-10-14-23(33-2)15-11-20)26(31)9-6-18-34-24-16-12-21(28)13-17-24/h10-17,22,25H,3-9,18-19H2,1-2H3,(H,29,32) |
| InChIKey | XLHIJFSFMWUBNK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.04 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|