C26H34Cl2N2O4 — CID 100722174
(2S)-N-[(2R)-butan-2-yl]-2-[(2,4-dichlorophenyl)methyl-[4-(4-methoxyphenoxy)butanoyl]amino]butanamide (PubChem CID 100722174) has the molecular formula C26H34Cl2N2O4 and a molecular weight of 509.47 g/mol. Its IUPAC name is (2S)-N-[(2R)-butan-2-yl]-2-[(2,4-dichlorophenyl)methyl-[4-(4-methoxyphenoxy)butanoyl]amino]butanamide.
| Compound Name | (2S)-N-[(2R)-butan-2-yl]-2-[(2,4-dichlorophenyl)methyl-[4-(4-methoxyphenoxy)butanoyl]amino]butanamide |
|---|---|
| PubChem CID | 100722174 |
| Molecular Formula | C26H34Cl2N2O4 |
| Molecular Weight | 509.47 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | (2S)-N-[(2R)-butan-2-yl]-2-[(2,4-dichlorophenyl)methyl-[4-(4-methoxyphenoxy)butanoyl]amino]butanamide |
| SMILES | CC[C@@H](C)NC(=O)[C@H](CC)N(Cc1ccc(Cl)cc1Cl)C(=O)CCCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H34Cl2N2O4/c1-5-18(3)29-26(32)24(6-2)30(17-19-9-10-20(27)16-23(19)28)25(31)8-7-15-34-22-13-11-21(33-4)12-14-22/h9-14,16,18,24H,5-8,15,17H2,1-4H3,(H,29,32)/t18-,24+/m1/s1 |
| InChIKey | ANKFJFABRQIBOG-KOSHJBKYSA-N |
| XLogP | 5.88 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.47 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|