C19H28Cl2N2O2 — CID 132703691
2-[butanoyl-[(2,4-dichlorophenyl)methyl]amino]-N-butan-2-ylbutanamide (PubChem CID 132703691) has the molecular formula C19H28Cl2N2O2 and a molecular weight of 387.35 g/mol. Its IUPAC name is 2-[butanoyl-[(2,4-dichlorophenyl)methyl]amino]-N-butan-2-ylbutanamide.
| Compound Name | 2-[butanoyl-[(2,4-dichlorophenyl)methyl]amino]-N-butan-2-ylbutanamide |
|---|---|
| PubChem CID | 132703691 |
| Molecular Formula | C19H28Cl2N2O2 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-[butanoyl-[(2,4-dichlorophenyl)methyl]amino]-N-butan-2-ylbutanamide |
| SMILES | CCCC(=O)N(Cc1ccc(Cl)cc1Cl)C(CC)C(=O)NC(C)CC |
| InChI | InChI=1S/C19H28Cl2N2O2/c1-5-8-18(24)23(12-14-9-10-15(20)11-16(14)21)17(7-3)19(25)22-13(4)6-2/h9-11,13,17H,5-8,12H2,1-4H3,(H,22,25) |
| InChIKey | JBTHBPKAGOEDIM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |