C17H24Cl2N2O2 — CID 132654097
2-[butanoyl-[(2,4-dichlorophenyl)methyl]amino]-N-ethylbutanamide (PubChem CID 132654097) has the molecular formula C17H24Cl2N2O2 and a molecular weight of 359.30 g/mol. Its IUPAC name is 2-[butanoyl-[(2,4-dichlorophenyl)methyl]amino]-N-ethylbutanamide.
| Compound Name | 2-[butanoyl-[(2,4-dichlorophenyl)methyl]amino]-N-ethylbutanamide |
|---|---|
| PubChem CID | 132654097 |
| Molecular Formula | C17H24Cl2N2O2 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 2-[butanoyl-[(2,4-dichlorophenyl)methyl]amino]-N-ethylbutanamide |
| SMILES | CCCC(=O)N(Cc1ccc(Cl)cc1Cl)C(CC)C(=O)NCC |
| InChI | InChI=1S/C17H24Cl2N2O2/c1-4-7-16(22)21(15(5-2)17(23)20-6-3)11-12-8-9-13(18)10-14(12)19/h8-10,15H,4-7,11H2,1-3H3,(H,20,23) |
| InChIKey | PZLWOQSIHSEJJH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |