C24H30Cl2N2O2 — CID 100688490
N-[(2R)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,4-dichlorophenyl)methyl]butanamide (PubChem CID 100688490) has the molecular formula C24H30Cl2N2O2 and a molecular weight of 449.42 g/mol. Its IUPAC name is N-[(2R)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,4-dichlorophenyl)methyl]butanamide.
| Compound Name | N-[(2R)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,4-dichlorophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 100688490 |
| Molecular Formula | C24H30Cl2N2O2 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | N-[(2R)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,4-dichlorophenyl)methyl]butanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccc(Cl)cc1Cl)C(=O)CCC |
| InChI | InChI=1S/C24H30Cl2N2O2/c1-3-5-14-27-24(30)22(15-18-10-7-6-8-11-18)28(23(29)9-4-2)17-19-12-13-20(25)16-21(19)26/h6-8,10-13,16,22H,3-5,9,14-15,17H2,1-2H3,(H,27,30)/t22-/m1/s1 |
| InChIKey | XIZLVDJZTDRVHR-JOCHJYFZSA-N |
| XLogP | 5.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|