C28H28Cl4N2O2 — CID 100688664
(2R)-N-butyl-2-[[2-(2,6-dichlorophenyl)acetyl]-[(2,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100688664) has the molecular formula C28H28Cl4N2O2 and a molecular weight of 566.36 g/mol. Its IUPAC name is (2R)-N-butyl-2-[[2-(2,6-dichlorophenyl)acetyl]-[(2,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[[2-(2,6-dichlorophenyl)acetyl]-[(2,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100688664 |
| Molecular Formula | C28H28Cl4N2O2 |
| Molecular Weight | 566.36 g/mol |
| Exact Mass | 564.09 |
| IUPAC Name | (2R)-N-butyl-2-[[2-(2,6-dichlorophenyl)acetyl]-[(2,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccc(Cl)cc1Cl)C(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C28H28Cl4N2O2/c1-2-3-14-33-28(36)26(15-19-8-5-4-6-9-19)34(18-20-12-13-21(29)16-25(20)32)27(35)17-22-23(30)10-7-11-24(22)31/h4-13,16,26H,2-3,14-15,17-18H2,1H3,(H,33,36)/t26-/m1/s1 |
| InChIKey | RPZYRMYPKJCZML-AREMUKBSSA-N |
| XLogP | 7.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.36 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|