C28H29Cl2FN2O2 — CID 133206988
N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(2-fluorophenyl)acetyl]amino]-3-phenylpropanamide (PubChem CID 133206988) has the molecular formula C28H29Cl2FN2O2 and a molecular weight of 515.46 g/mol. Its IUPAC name is N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(2-fluorophenyl)acetyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(2-fluorophenyl)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133206988 |
| Molecular Formula | C28H29Cl2FN2O2 |
| Molecular Weight | 515.46 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(2-fluorophenyl)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)cc1Cl)C(=O)Cc1ccccc1F |
| InChI | InChI=1S/C28H29Cl2FN2O2/c1-2-3-15-32-28(35)26(16-20-9-5-4-6-10-20)33(19-22-13-14-23(29)18-24(22)30)27(34)17-21-11-7-8-12-25(21)31/h4-14,18,26H,2-3,15-17,19H2,1H3,(H,32,35) |
| InChIKey | DHLLBCJQXCYWPK-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.46 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|