C33H40Cl2N2O2 — CID 133206870
N-butyl-2-[3-(4-tert-butylphenyl)propanoyl-[(2,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 133206870) has the molecular formula C33H40Cl2N2O2 and a molecular weight of 567.60 g/mol. Its IUPAC name is N-butyl-2-[3-(4-tert-butylphenyl)propanoyl-[(2,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[3-(4-tert-butylphenyl)propanoyl-[(2,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133206870 |
| Molecular Formula | C33H40Cl2N2O2 |
| Molecular Weight | 567.60 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | N-butyl-2-[3-(4-tert-butylphenyl)propanoyl-[(2,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)cc1Cl)C(=O)CCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C33H40Cl2N2O2/c1-5-6-20-36-32(39)30(21-25-10-8-7-9-11-25)37(23-26-15-18-28(34)22-29(26)35)31(38)19-14-24-12-16-27(17-13-24)33(2,3)4/h7-13,15-18,22,30H,5-6,14,19-21,23H2,1-4H3,(H,36,39) |
| InChIKey | MPDCAHOOWIEYRL-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.60 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|