C25H32Cl2N2O3 — CID 100722041
(2R)-N-[(2S)-butan-2-yl]-2-[(2,4-dichlorophenyl)methyl-(4-phenoxybutanoyl)amino]butanamide (PubChem CID 100722041) has the molecular formula C25H32Cl2N2O3 and a molecular weight of 479.45 g/mol. Its IUPAC name is (2R)-N-[(2S)-butan-2-yl]-2-[(2,4-dichlorophenyl)methyl-(4-phenoxybutanoyl)amino]butanamide.
| Compound Name | (2R)-N-[(2S)-butan-2-yl]-2-[(2,4-dichlorophenyl)methyl-(4-phenoxybutanoyl)amino]butanamide |
|---|---|
| PubChem CID | 100722041 |
| Molecular Formula | C25H32Cl2N2O3 |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | (2R)-N-[(2S)-butan-2-yl]-2-[(2,4-dichlorophenyl)methyl-(4-phenoxybutanoyl)amino]butanamide |
| SMILES | CC[C@H](C(=O)N[C@@H](C)CC)N(Cc1ccc(Cl)cc1Cl)C(=O)CCCOc1ccccc1 |
| InChI | InChI=1S/C25H32Cl2N2O3/c1-4-18(3)28-25(31)23(5-2)29(17-19-13-14-20(26)16-22(19)27)24(30)12-9-15-32-21-10-7-6-8-11-21/h6-8,10-11,13-14,16,18,23H,4-5,9,12,15,17H2,1-3H3,(H,28,31)/t18-,23+/m0/s1 |
| InChIKey | UFZVLNVKODUIPU-FDDCHVKYSA-N |
| XLogP | 5.87 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|